C21H30ClN3O2 — CID 119849610
N-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 119849610) has the molecular formula C21H30ClN3O2 and a molecular weight of 391.94 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 119849610 |
| Molecular Formula | C21H30ClN3O2 |
| Molecular Weight | 391.94 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | O=C(NCC(c1ccccc1Cl)N1CCOCC1)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C21H30ClN3O2/c22-17-7-3-2-6-16(17)20(25-9-11-27-12-10-25)14-23-21(26)19-13-15-5-1-4-8-18(15)24-19/h2-3,6-7,15,18-20,24H,1,4-5,8-14H2,(H,23,26) |
| InChIKey | RVAJXKUTZKVWLP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.94 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |