C20H31N3O4 — CID 119830138
N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]piperidine-2-carboxamide (PubChem CID 119830138) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]piperidine-2-carboxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 119830138 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]piperidine-2-carboxamide |
| SMILES | COc1ccc(C(CNC(=O)C2CCCCN2)N2CCOCC2)cc1OC |
| InChI | InChI=1S/C20H31N3O4/c1-25-18-7-6-15(13-19(18)26-2)17(23-9-11-27-12-10-23)14-22-20(24)16-5-3-4-8-21-16/h6-7,13,16-17,21H,3-5,8-12,14H2,1-2H3,(H,22,24) |
| InChIKey | POTAMCGGAMRDSH-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |