C20H32N4O3 — CID 110933783
N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 110933783) has the molecular formula C20H32N4O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-N'-methylpyrrolidine-1-carboximidamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-N'-methylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 110933783 |
| Molecular Formula | C20H32N4O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCC(c1ccc(OC)c(OC)c1)N1CCOCC1)N1CCCC1 |
| InChI | InChI=1S/C20H32N4O3/c1-21-20(24-8-4-5-9-24)22-15-17(23-10-12-27-13-11-23)16-6-7-18(25-2)19(14-16)26-3/h6-7,14,17H,4-5,8-13,15H2,1-3H3,(H,21,22) |
| InChIKey | WYQVDWISNSYNGZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|