C22H37IN4O3 — CID 111211600
N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-N',4-dimethylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111211600) has the molecular formula C22H37IN4O3 and a molecular weight of 532.47 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-N',4-dimethylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-N',4-dimethylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111211600 |
| Molecular Formula | C22H37IN4O3 |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-N',4-dimethylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCC(c1ccc(OC)c(OC)c1)N1CCOCC1)N1CCC(C)CC1.I |
| InChI | InChI=1S/C22H36N4O3.HI/c1-17-7-9-26(10-8-17)22(23-2)24-16-19(25-11-13-29-14-12-25)18-5-6-20(27-3)21(15-18)28-4;/h5-6,15,17,19H,7-14,16H2,1-4H3,(H,23,24);1H |
| InChIKey | RZOUPDYGCHNSDZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|