C20H35IN4O5S — CID 111312805
1-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-3-(2-ethylsulfonylethyl)-2-methylguanidine;hydroiodide (PubChem CID 111312805) has the molecular formula C20H35IN4O5S and a molecular weight of 570.49 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-3-(2-ethylsulfonylethyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-3-(2-ethylsulfonylethyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111312805 |
| Molecular Formula | C20H35IN4O5S |
| Molecular Weight | 570.49 g/mol |
| Exact Mass | 570.14 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-3-(2-ethylsulfonylethyl)-2-methylguanidine;hydroiodide |
| SMILES | CCS(=O)(=O)CCN/C(=N\C)NCC(c1ccc(OC)c(OC)c1)N1CCOCC1.I |
| InChI | InChI=1S/C20H34N4O5S.HI/c1-5-30(25,26)13-8-22-20(21-2)23-15-17(24-9-11-29-12-10-24)16-6-7-18(27-3)19(14-16)28-4;/h6-7,14,17H,5,8-13,15H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | HCQNJIHVAHHCPC-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.49 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|