C22H37N5O4 — CID 111312882
3-[[N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-N'-methylcarbamimidoyl]amino]-N-propan-2-ylpropanamide (PubChem CID 111312882) has the molecular formula C22H37N5O4 and a molecular weight of 435.57 g/mol. Its IUPAC name is 3-[[N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-N'-methylcarbamimidoyl]amino]-N-propan-2-ylpropanamide.
| Compound Name | 3-[[N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-N'-methylcarbamimidoyl]amino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 111312882 |
| Molecular Formula | C22H37N5O4 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.28 |
| IUPAC Name | 3-[[N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-N'-methylcarbamimidoyl]amino]-N-propan-2-ylpropanamide |
| SMILES | C/N=C(\NCCC(=O)NC(C)C)NCC(c1ccc(OC)c(OC)c1)N1CCOCC1 |
| InChI | InChI=1S/C22H37N5O4/c1-16(2)26-21(28)8-9-24-22(23-3)25-15-18(27-10-12-31-13-11-27)17-6-7-19(29-4)20(14-17)30-5/h6-7,14,16,18H,8-13,15H2,1-5H3,(H,26,28)(H2,23,24,25) |
| InChIKey | OKQLOGVKUPAJKA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|