C23H40IN5O4 — CID 111313145
N-butan-2-yl-3-[[N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-N'-methylcarbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111313145) has the molecular formula C23H40IN5O4 and a molecular weight of 577.51 g/mol. Its IUPAC name is N-butan-2-yl-3-[[N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-N'-methylcarbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-butan-2-yl-3-[[N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-N'-methylcarbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111313145 |
| Molecular Formula | C23H40IN5O4 |
| Molecular Weight | 577.51 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | N-butan-2-yl-3-[[N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-N'-methylcarbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | CCC(C)NC(=O)CCN/C(=N\C)NCC(c1ccc(OC)c(OC)c1)N1CCOCC1.I |
| InChI | InChI=1S/C23H39N5O4.HI/c1-6-17(2)27-22(29)9-10-25-23(24-3)26-16-19(28-11-13-32-14-12-28)18-7-8-20(30-4)21(15-18)31-5;/h7-8,15,17,19H,6,9-14,16H2,1-5H3,(H,27,29)(H2,24,25,26);1H |
| InChIKey | SBVJKWRNEFKZTO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.51 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|