C22H39N5O3 — CID 111765359
1-[2-(tert-butylamino)ethyl]-3-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-2-methylguanidine (PubChem CID 111765359) has the molecular formula C22H39N5O3 and a molecular weight of 421.59 g/mol. Its IUPAC name is 1-[2-(tert-butylamino)ethyl]-3-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-2-methylguanidine.
| Compound Name | 1-[2-(tert-butylamino)ethyl]-3-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111765359 |
| Molecular Formula | C22H39N5O3 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.31 |
| IUPAC Name | 1-[2-(tert-butylamino)ethyl]-3-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCNC(C)(C)C)NCC(c1ccc(OC)c(OC)c1)N1CCOCC1 |
| InChI | InChI=1S/C22H39N5O3/c1-22(2,3)26-10-9-24-21(23-4)25-16-18(27-11-13-30-14-12-27)17-7-8-19(28-5)20(15-17)29-6/h7-8,15,18,26H,9-14,16H2,1-6H3,(H2,23,24,25) |
| InChIKey | YNUBJMXGZNMXRM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|