C23H39N5O4 — CID 111312952
3-[[N'-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-N-ethylcarbamimidoyl]amino]-N-propan-2-ylpropanamide (PubChem CID 111312952) has the molecular formula C23H39N5O4 and a molecular weight of 449.60 g/mol. Its IUPAC name is 3-[[N'-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-N-ethylcarbamimidoyl]amino]-N-propan-2-ylpropanamide.
| Compound Name | 3-[[N'-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-N-ethylcarbamimidoyl]amino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 111312952 |
| Molecular Formula | C23H39N5O4 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.30 |
| IUPAC Name | 3-[[N'-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-N-ethylcarbamimidoyl]amino]-N-propan-2-ylpropanamide |
| SMILES | CCN/C(=N\CC(c1ccc(OC)c(OC)c1)N1CCOCC1)NCCC(=O)NC(C)C |
| InChI | InChI=1S/C23H39N5O4/c1-6-24-23(25-10-9-22(29)27-17(2)3)26-16-19(28-11-13-32-14-12-28)18-7-8-20(30-4)21(15-18)31-5/h7-8,15,17,19H,6,9-14,16H2,1-5H3,(H,27,29)(H2,24,25,26) |
| InChIKey | YPZBMZSMFPVCLF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|