C24H42IN5O3 — CID 111313055
2-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-1-ethyl-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide (PubChem CID 111313055) has the molecular formula C24H42IN5O3 and a molecular weight of 575.54 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-1-ethyl-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-1-ethyl-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111313055 |
| Molecular Formula | C24H42IN5O3 |
| Molecular Weight | 575.54 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-1-ethyl-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccc(OC)c(OC)c1)N1CCOCC1)NCCN1CCCCC1.I |
| InChI | InChI=1S/C24H41N5O3.HI/c1-4-25-24(26-10-13-28-11-6-5-7-12-28)27-19-21(29-14-16-32-17-15-29)20-8-9-22(30-2)23(18-20)31-3;/h8-9,18,21H,4-7,10-17,19H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | VSJJTBJOPTYLLY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.54 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|