C22H34N6O3 — CID 111313148
2-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-1-ethyl-3-(2-pyrazol-1-ylethyl)guanidine (PubChem CID 111313148) has the molecular formula C22H34N6O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-1-ethyl-3-(2-pyrazol-1-ylethyl)guanidine.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-1-ethyl-3-(2-pyrazol-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111313148 |
| Molecular Formula | C22H34N6O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-1-ethyl-3-(2-pyrazol-1-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(c1ccc(OC)c(OC)c1)N1CCOCC1)NCCn1cccn1 |
| InChI | InChI=1S/C22H34N6O3/c1-4-23-22(24-9-11-28-10-5-8-26-28)25-17-19(27-12-14-31-15-13-27)18-6-7-20(29-2)21(16-18)30-3/h5-8,10,16,19H,4,9,11-15,17H2,1-3H3,(H2,23,24,25) |
| InChIKey | YSJKFJXQRUXFJE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|