C20H32F3IN4O3 — CID 111778624
2-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 111778624) has the molecular formula C20H32F3IN4O3 and a molecular weight of 560.40 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111778624 |
| Molecular Formula | C20H32F3IN4O3 |
| Molecular Weight | 560.40 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccc(OC)c(OC)c1)N1CCOCC1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C20H31F3N4O3.HI/c1-4-24-19(25-8-7-20(21,22)23)26-14-16(27-9-11-30-12-10-27)15-5-6-17(28-2)18(13-15)29-3;/h5-6,13,16H,4,7-12,14H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | ZGVPYACRZQXBCM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|