C19H29F3N4O2 — CID 111778609
1-ethyl-2-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 111778609) has the molecular formula C19H29F3N4O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 1-ethyl-2-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-ethyl-2-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 111778609 |
| Molecular Formula | C19H29F3N4O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 1-ethyl-2-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\CC(c1ccc(OC)cc1)N1CCOCC1)NCCC(F)(F)F |
| InChI | InChI=1S/C19H29F3N4O2/c1-3-23-18(24-9-8-19(20,21)22)25-14-17(26-10-12-28-13-11-26)15-4-6-16(27-2)7-5-15/h4-7,17H,3,8-14H2,1-2H3,(H2,23,24,25) |
| InChIKey | MKFBHAOQMXRRHE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|