C20H35N5O4S — CID 111309472
1-ethyl-3-[3-(methanesulfonamido)propyl]-2-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]guanidine (PubChem CID 111309472) has the molecular formula C20H35N5O4S and a molecular weight of 441.60 g/mol. Its IUPAC name is 1-ethyl-3-[3-(methanesulfonamido)propyl]-2-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]guanidine.
| Compound Name | 1-ethyl-3-[3-(methanesulfonamido)propyl]-2-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]guanidine |
|---|---|
| PubChem CID | 111309472 |
| Molecular Formula | C20H35N5O4S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 1-ethyl-3-[3-(methanesulfonamido)propyl]-2-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]guanidine |
| SMILES | CCN/C(=N\CC(c1ccc(OC)cc1)N1CCOCC1)NCCCNS(C)(=O)=O |
| InChI | InChI=1S/C20H35N5O4S/c1-4-21-20(22-10-5-11-24-30(3,26)27)23-16-19(25-12-14-29-15-13-25)17-6-8-18(28-2)9-7-17/h6-9,19,24H,4-5,10-16H2,1-3H3,(H2,21,22,23) |
| InChIKey | NCRBYPNRTSDQRE-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|