C24H42IN5O2 — CID 111291862
1-ethyl-2-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-(4-morpholin-4-ylbutyl)guanidine;hydroiodide (PubChem CID 111291862) has the molecular formula C24H42IN5O2 and a molecular weight of 559.54 g/mol. Its IUPAC name is 1-ethyl-2-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-(4-morpholin-4-ylbutyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-(4-morpholin-4-ylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111291862 |
| Molecular Formula | C24H42IN5O2 |
| Molecular Weight | 559.54 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | 1-ethyl-2-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-(4-morpholin-4-ylbutyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccc(OC)cc1)N1CCCC1)NCCCCN1CCOCC1.I |
| InChI | InChI=1S/C24H41N5O2.HI/c1-3-25-24(26-12-4-5-13-28-16-18-31-19-17-28)27-20-23(29-14-6-7-15-29)21-8-10-22(30-2)11-9-21;/h8-11,23H,3-7,12-20H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | LJRQYOPMSMKLIH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|