C24H41N5O2 — CID 111291621
1-ethyl-3-[3-(4-hydroxypiperidin-1-yl)propyl]-2-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine (PubChem CID 111291621) has the molecular formula C24H41N5O2 and a molecular weight of 431.63 g/mol. Its IUPAC name is 1-ethyl-3-[3-(4-hydroxypiperidin-1-yl)propyl]-2-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine.
| Compound Name | 1-ethyl-3-[3-(4-hydroxypiperidin-1-yl)propyl]-2-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine |
|---|---|
| PubChem CID | 111291621 |
| Molecular Formula | C24H41N5O2 |
| Molecular Weight | 431.63 g/mol |
| Exact Mass | 431.33 |
| IUPAC Name | 1-ethyl-3-[3-(4-hydroxypiperidin-1-yl)propyl]-2-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine |
| SMILES | CCN/C(=N\CC(c1ccc(OC)cc1)N1CCCC1)NCCCN1CCC(O)CC1 |
| InChI | InChI=1S/C24H41N5O2/c1-3-25-24(26-13-6-14-28-17-11-21(30)12-18-28)27-19-23(29-15-4-5-16-29)20-7-9-22(31-2)10-8-20/h7-10,21,23,30H,3-6,11-19H2,1-2H3,(H2,25,26,27) |
| InChIKey | MGAZFPFIMZOBKS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.63 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|