C18H32IN5O4S — CID 111309975
1-ethyl-2-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-3-(2-sulfamoylethyl)guanidine;hydroiodide (PubChem CID 111309975) has the molecular formula C18H32IN5O4S and a molecular weight of 541.46 g/mol. Its IUPAC name is 1-ethyl-2-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-3-(2-sulfamoylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-3-(2-sulfamoylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111309975 |
| Molecular Formula | C18H32IN5O4S |
| Molecular Weight | 541.46 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | 1-ethyl-2-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-3-(2-sulfamoylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccc(OC)cc1)N1CCOCC1)NCCS(N)(=O)=O.I |
| InChI | InChI=1S/C18H31N5O4S.HI/c1-3-20-18(21-8-13-28(19,24)25)22-14-17(23-9-11-27-12-10-23)15-4-6-16(26-2)7-5-15;/h4-7,17H,3,8-14H2,1-2H3,(H2,19,24,25)(H2,20,21,22);1H |
| InChIKey | QDADPYSGJUESIR-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.46 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|