C19H33N5O5S — CID 111313102
2-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-1-ethyl-3-(2-sulfamoylethyl)guanidine (PubChem CID 111313102) has the molecular formula C19H33N5O5S and a molecular weight of 443.57 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-1-ethyl-3-(2-sulfamoylethyl)guanidine.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-1-ethyl-3-(2-sulfamoylethyl)guanidine |
|---|---|
| PubChem CID | 111313102 |
| Molecular Formula | C19H33N5O5S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-1-ethyl-3-(2-sulfamoylethyl)guanidine |
| SMILES | CCN/C(=N\CC(c1ccc(OC)c(OC)c1)N1CCOCC1)NCCS(N)(=O)=O |
| InChI | InChI=1S/C19H33N5O5S/c1-4-21-19(22-7-12-30(20,25)26)23-14-16(24-8-10-29-11-9-24)15-5-6-17(27-2)18(13-15)28-3/h5-6,13,16H,4,7-12,14H2,1-3H3,(H2,20,25,26)(H2,21,22,23) |
| InChIKey | DPSSWDZUKDMORK-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|