C23H40IN5O3 — CID 111312819
1-[2-cyclopropyl-2-(dimethylamino)ethyl]-3-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-2-methylguanidine;hydroiodide (PubChem CID 111312819) has the molecular formula C23H40IN5O3 and a molecular weight of 561.51 g/mol. Its IUPAC name is 1-[2-cyclopropyl-2-(dimethylamino)ethyl]-3-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-cyclopropyl-2-(dimethylamino)ethyl]-3-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111312819 |
| Molecular Formula | C23H40IN5O3 |
| Molecular Weight | 561.51 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | 1-[2-cyclopropyl-2-(dimethylamino)ethyl]-3-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC(C1CC1)N(C)C)NCC(c1ccc(OC)c(OC)c1)N1CCOCC1.I |
| InChI | InChI=1S/C23H39N5O3.HI/c1-24-23(25-15-19(27(2)3)17-6-7-17)26-16-20(28-10-12-31-13-11-28)18-8-9-21(29-4)22(14-18)30-5;/h8-9,14,17,19-20H,6-7,10-13,15-16H2,1-5H3,(H2,24,25,26);1H |
| InChIKey | UBUNVELNUIUAHA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.51 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|