C21H34FN5O — CID 111311744
1-[2-cyclopropyl-2-(dimethylamino)ethyl]-3-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine (PubChem CID 111311744) has the molecular formula C21H34FN5O and a molecular weight of 391.54 g/mol. Its IUPAC name is 1-[2-cyclopropyl-2-(dimethylamino)ethyl]-3-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine.
| Compound Name | 1-[2-cyclopropyl-2-(dimethylamino)ethyl]-3-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111311744 |
| Molecular Formula | C21H34FN5O |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | 1-[2-cyclopropyl-2-(dimethylamino)ethyl]-3-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCC(C1CC1)N(C)C)NCC(c1ccc(F)cc1)N1CCOCC1 |
| InChI | InChI=1S/C21H34FN5O/c1-23-21(24-14-19(26(2)3)16-4-5-16)25-15-20(27-10-12-28-13-11-27)17-6-8-18(22)9-7-17/h6-9,16,19-20H,4-5,10-15H2,1-3H3,(H2,23,24,25) |
| InChIKey | NKXCCRRBSGOGSO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|