C13H18Cl2N2O2 — CID 110887592
N-[2-(4-chlorophenyl)-2-hydroxyethyl]pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 110887592) has the molecular formula C13H18Cl2N2O2 and a molecular weight of 305.20 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-hydroxyethyl]pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | N-[2-(4-chlorophenyl)-2-hydroxyethyl]pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 110887592 |
| Molecular Formula | C13H18Cl2N2O2 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-hydroxyethyl]pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCC(O)c1ccc(Cl)cc1)C1CCCN1 |
| InChI | InChI=1S/C13H17ClN2O2.ClH/c14-10-5-3-9(4-6-10)12(17)8-16-13(18)11-2-1-7-15-11;/h3-6,11-12,15,17H,1-2,7-8H2,(H,16,18);1H |
| InChIKey | INCCITRQSYFABZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |