C14H19ClN2O — CID 11521840
N-[2-(4-chlorophenyl)ethyl]piperidine-2-carboxamide (PubChem CID 11521840) has the molecular formula C14H19ClN2O and a molecular weight of 266.77 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]piperidine-2-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 11521840 |
| Molecular Formula | C14H19ClN2O |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]piperidine-2-carboxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)C1CCCCN1 |
| InChI | InChI=1S/C14H19ClN2O/c15-12-6-4-11(5-7-12)8-10-17-14(18)13-3-1-2-9-16-13/h4-7,13,16H,1-3,8-10H2,(H,17,18) |
| InChIKey | ZYKIDGXZSKPGJN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |