C24H28Cl2N2O2 — CID 26644708
1-N,4-N-bis[2-(4-chlorophenyl)ethyl]cyclohexane-1,4-dicarboxamide (PubChem CID 26644708) has the molecular formula C24H28Cl2N2O2 and a molecular weight of 447.41 g/mol. Its IUPAC name is 1-N,4-N-bis[2-(4-chlorophenyl)ethyl]cyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[2-(4-chlorophenyl)ethyl]cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 26644708 |
| Molecular Formula | C24H28Cl2N2O2 |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 1-N,4-N-bis[2-(4-chlorophenyl)ethyl]cyclohexane-1,4-dicarboxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)C1CCC(C(=O)NCCc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C24H28Cl2N2O2/c25-21-9-1-17(2-10-21)13-15-27-23(29)19-5-7-20(8-6-19)24(30)28-16-14-18-3-11-22(26)12-4-18/h1-4,9-12,19-20H,5-8,13-16H2,(H,27,29)(H,28,30) |
| InChIKey | RZLPLIFLRGBWLE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |