C22H25Cl2N3O2 — CID 154961412
(3R,4R)-3-N,4-N-bis[2-(4-chlorophenyl)ethyl]pyrrolidine-3,4-dicarboxamide (PubChem CID 154961412) has the molecular formula C22H25Cl2N3O2 and a molecular weight of 434.37 g/mol. Its IUPAC name is (3R,4R)-3-N,4-N-bis[2-(4-chlorophenyl)ethyl]pyrrolidine-3,4-dicarboxamide.
| Compound Name | (3R,4R)-3-N,4-N-bis[2-(4-chlorophenyl)ethyl]pyrrolidine-3,4-dicarboxamide |
|---|---|
| PubChem CID | 154961412 |
| Molecular Formula | C22H25Cl2N3O2 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | (3R,4R)-3-N,4-N-bis[2-(4-chlorophenyl)ethyl]pyrrolidine-3,4-dicarboxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)[C@H]1CNC[C@@H]1C(=O)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H25Cl2N3O2/c23-17-5-1-15(2-6-17)9-11-26-21(28)19-13-25-14-20(19)22(29)27-12-10-16-3-7-18(24)8-4-16/h1-8,19-20,25H,9-14H2,(H,26,28)(H,27,29)/t19-,20-/m0/s1 |
| InChIKey | MHEWPAHKYOHOAP-PMACEKPBSA-N |
| XLogP | 2.85 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |