C23H25Cl2N3O4 — CID 154961386
3,4-bis[2-(4-chlorophenyl)ethylcarbamoyl]pyrrolidine-1-carboxylic acid (PubChem CID 154961386) has the molecular formula C23H25Cl2N3O4 and a molecular weight of 478.38 g/mol. Its IUPAC name is 3,4-bis[2-(4-chlorophenyl)ethylcarbamoyl]pyrrolidine-1-carboxylic acid.
| Compound Name | 3,4-bis[2-(4-chlorophenyl)ethylcarbamoyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 154961386 |
| Molecular Formula | C23H25Cl2N3O4 |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 3,4-bis[2-(4-chlorophenyl)ethylcarbamoyl]pyrrolidine-1-carboxylic acid |
| SMILES | O=C(NCCc1ccc(Cl)cc1)C1CN(C(=O)O)CC1C(=O)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H25Cl2N3O4/c24-17-5-1-15(2-6-17)9-11-26-21(29)19-13-28(23(31)32)14-20(19)22(30)27-12-10-16-3-7-18(25)8-4-16/h1-8,19-20H,9-14H2,(H,26,29)(H,27,30)(H,31,32) |
| InChIKey | GFRMZGCNANAEJS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |