C15H18N4O2 — CID 175163144
3-N-[2-(4-cyanophenyl)ethyl]pyrrolidine-3,4-dicarboxamide (PubChem CID 175163144) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 3-N-[2-(4-cyanophenyl)ethyl]pyrrolidine-3,4-dicarboxamide.
| Compound Name | 3-N-[2-(4-cyanophenyl)ethyl]pyrrolidine-3,4-dicarboxamide |
|---|---|
| PubChem CID | 175163144 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 3-N-[2-(4-cyanophenyl)ethyl]pyrrolidine-3,4-dicarboxamide |
| SMILES | N#Cc1ccc(CCNC(=O)C2CNCC2C(N)=O)cc1 |
| InChI | InChI=1S/C15H18N4O2/c16-7-11-3-1-10(2-4-11)5-6-19-15(21)13-9-18-8-12(13)14(17)20/h1-4,12-13,18H,5-6,8-9H2,(H2,17,20)(H,19,21) |
| InChIKey | VAXFRYBRWOQEFQ-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |