C24H25N5O2 — CID 154961395
(3R,4R)-3-N,4-N-bis[2-(4-cyanophenyl)ethyl]pyrrolidine-3,4-dicarboxamide (PubChem CID 154961395) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is (3R,4R)-3-N,4-N-bis[2-(4-cyanophenyl)ethyl]pyrrolidine-3,4-dicarboxamide.
| Compound Name | (3R,4R)-3-N,4-N-bis[2-(4-cyanophenyl)ethyl]pyrrolidine-3,4-dicarboxamide |
|---|---|
| PubChem CID | 154961395 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | (3R,4R)-3-N,4-N-bis[2-(4-cyanophenyl)ethyl]pyrrolidine-3,4-dicarboxamide |
| SMILES | N#Cc1ccc(CCNC(=O)[C@H]2CNC[C@@H]2C(=O)NCCc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C24H25N5O2/c25-13-19-5-1-17(2-6-19)9-11-28-23(30)21-15-27-16-22(21)24(31)29-12-10-18-3-7-20(14-26)8-4-18/h1-8,21-22,27H,9-12,15-16H2,(H,28,30)(H,29,31)/t21-,22-/m0/s1 |
| InChIKey | DGLJOIGIDDRWAZ-VXKWHMMOSA-N |
| XLogP | 1.28 |
| TPSA | 117.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |