C22H32F2IN5O — CID 111791341
1-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide (PubChem CID 111791341) has the molecular formula C22H32F2IN5O and a molecular weight of 547.43 g/mol. Its IUPAC name is 1-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111791341 |
| Molecular Formula | C22H32F2IN5O |
| Molecular Weight | 547.43 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | 1-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCC(c1c(F)cccc1F)N(C)C)NCC(c1ccco1)N1CCCC1.I |
| InChI | InChI=1S/C22H31F2N5O.HI/c1-25-22(26-14-18(20-10-7-13-30-20)29-11-4-5-12-29)27-15-19(28(2)3)21-16(23)8-6-9-17(21)24;/h6-10,13,18-19H,4-5,11-12,14-15H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | IXLFHIRUMYMQCZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 56.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|