C21H35N7O — CID 111795415
1-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine (PubChem CID 111795415) has the molecular formula C21H35N7O and a molecular weight of 401.56 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine.
| Compound Name | 1-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111795415 |
| Molecular Formula | C21H35N7O |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.29 |
| IUPAC Name | 1-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCC(c1cnn(C)c1)N(C)C)NCC(c1ccco1)N1CCCCC1 |
| InChI | InChI=1S/C21H35N7O/c1-22-21(23-14-18(26(2)3)17-13-25-27(4)16-17)24-15-19(20-9-8-12-29-20)28-10-6-5-7-11-28/h8-9,12-13,16,18-19H,5-7,10-11,14-15H2,1-4H3,(H2,22,23,24) |
| InChIKey | IGLUPTSCRXJGCJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|