C22H29FIN5OS — CID 111283640
1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111283640) has the molecular formula C22H29FIN5OS and a molecular weight of 557.48 g/mol. Its IUPAC name is 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111283640 |
| Molecular Formula | C22H29FIN5OS |
| Molecular Weight | 557.48 g/mol |
| Exact Mass | 557.11 |
| IUPAC Name | 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2cc(F)ccc12)NCC(c1cccs1)N1CCOCC1.I |
| InChI | InChI=1S/C22H28FN5OS.HI/c1-24-22(25-7-6-16-14-26-19-13-17(23)4-5-18(16)19)27-15-20(21-3-2-12-30-21)28-8-10-29-11-9-28;/h2-5,12-14,20,26H,6-11,15H2,1H3,(H2,24,25,27);1H |
| InChIKey | LREBQKXMJAPVBC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|