C25H33N5O — CID 111973612
2-methyl-1-[2-(6-methyl-1H-indol-3-yl)ethyl]-3-(2-morpholin-4-yl-2-phenylethyl)guanidine (PubChem CID 111973612) has the molecular formula C25H33N5O and a molecular weight of 419.57 g/mol. Its IUPAC name is 2-methyl-1-[2-(6-methyl-1H-indol-3-yl)ethyl]-3-(2-morpholin-4-yl-2-phenylethyl)guanidine.
| Compound Name | 2-methyl-1-[2-(6-methyl-1H-indol-3-yl)ethyl]-3-(2-morpholin-4-yl-2-phenylethyl)guanidine |
|---|---|
| PubChem CID | 111973612 |
| Molecular Formula | C25H33N5O |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | 2-methyl-1-[2-(6-methyl-1H-indol-3-yl)ethyl]-3-(2-morpholin-4-yl-2-phenylethyl)guanidine |
| SMILES | C/N=C(/NCCc1c[nH]c2cc(C)ccc12)NCC(c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C25H33N5O/c1-19-8-9-22-21(17-28-23(22)16-19)10-11-27-25(26-2)29-18-24(20-6-4-3-5-7-20)30-12-14-31-15-13-30/h3-9,16-17,24,28H,10-15,18H2,1-2H3,(H2,26,27,29) |
| InChIKey | UWZNQOZMEUXTLW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|