C24H33N5OS — CID 111985639
1-[3-(1H-indol-3-yl)propyl]-2-methyl-3-[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]guanidine (PubChem CID 111985639) has the molecular formula C24H33N5OS and a molecular weight of 439.63 g/mol. Its IUPAC name is 1-[3-(1H-indol-3-yl)propyl]-2-methyl-3-[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]guanidine.
| Compound Name | 1-[3-(1H-indol-3-yl)propyl]-2-methyl-3-[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]guanidine |
|---|---|
| PubChem CID | 111985639 |
| Molecular Formula | C24H33N5OS |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 1-[3-(1H-indol-3-yl)propyl]-2-methyl-3-[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]guanidine |
| SMILES | C/N=C(/NCCCc1c[nH]c2ccccc12)NCC(c1ccc(C)s1)N1CCOCC1 |
| InChI | InChI=1S/C24H33N5OS/c1-18-9-10-23(31-18)22(29-12-14-30-15-13-29)17-28-24(25-2)26-11-5-6-19-16-27-21-8-4-3-7-20(19)21/h3-4,7-10,16,22,27H,5-6,11-15,17H2,1-2H3,(H2,25,26,28) |
| InChIKey | XPJBPBHTFJCBOA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|