C19H25IN4S — CID 111987746
1-[3-(1H-indol-3-yl)propyl]-2-methyl-3-[(5-methylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111987746) has the molecular formula C19H25IN4S and a molecular weight of 468.41 g/mol. Its IUPAC name is 1-[3-(1H-indol-3-yl)propyl]-2-methyl-3-[(5-methylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(1H-indol-3-yl)propyl]-2-methyl-3-[(5-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111987746 |
| Molecular Formula | C19H25IN4S |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 1-[3-(1H-indol-3-yl)propyl]-2-methyl-3-[(5-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCc1c[nH]c2ccccc12)NCc1ccc(C)s1.I |
| InChI | InChI=1S/C19H24N4S.HI/c1-14-9-10-16(24-14)13-23-19(20-2)21-11-5-6-15-12-22-18-8-4-3-7-17(15)18;/h3-4,7-10,12,22H,5-6,11,13H2,1-2H3,(H2,20,21,23);1H |
| InChIKey | NBSUTRWHVIBTQG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|