C21H29N5O — CID 111984033
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[3-(1H-indol-3-yl)propyl]-2-methylguanidine (PubChem CID 111984033) has the molecular formula C21H29N5O and a molecular weight of 367.50 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[3-(1H-indol-3-yl)propyl]-2-methylguanidine.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[3-(1H-indol-3-yl)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111984033 |
| Molecular Formula | C21H29N5O |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[3-(1H-indol-3-yl)propyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCCc1c[nH]c2ccccc12)NCc1ncc(C(C)(C)C)o1 |
| InChI | InChI=1S/C21H29N5O/c1-21(2,3)18-13-25-19(27-18)14-26-20(22-4)23-11-7-8-15-12-24-17-10-6-5-9-16(15)17/h5-6,9-10,12-13,24H,7-8,11,14H2,1-4H3,(H2,22,23,26) |
| InChIKey | HBJNHFLENOFRHV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 78.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|