C19H25N5S — CID 111983601
1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-[3-(1H-indol-3-yl)propyl]-2-methylguanidine (PubChem CID 111983601) has the molecular formula C19H25N5S and a molecular weight of 355.51 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-[3-(1H-indol-3-yl)propyl]-2-methylguanidine.
| Compound Name | 1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-[3-(1H-indol-3-yl)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111983601 |
| Molecular Formula | C19H25N5S |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-[3-(1H-indol-3-yl)propyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCCc1c[nH]c2ccccc12)NCc1nc(C)c(C)s1 |
| InChI | InChI=1S/C19H25N5S/c1-13-14(2)25-18(24-13)12-23-19(20-3)21-10-6-7-15-11-22-17-9-5-4-8-16(15)17/h4-5,8-9,11,22H,6-7,10,12H2,1-3H3,(H2,20,21,23) |
| InChIKey | AQVMLVSTVGSTQU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|