C18H28N4 — CID 111753236
1-[3-(1H-indol-3-yl)propyl]-2-methyl-3-pentylguanidine (PubChem CID 111753236) has the molecular formula C18H28N4 and a molecular weight of 300.45 g/mol. Its IUPAC name is 1-[3-(1H-indol-3-yl)propyl]-2-methyl-3-pentylguanidine.
| Compound Name | 1-[3-(1H-indol-3-yl)propyl]-2-methyl-3-pentylguanidine |
|---|---|
| PubChem CID | 111753236 |
| Molecular Formula | C18H28N4 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | 1-[3-(1H-indol-3-yl)propyl]-2-methyl-3-pentylguanidine |
| SMILES | CCCCCN/C(=N\C)NCCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H28N4/c1-3-4-7-12-20-18(19-2)21-13-8-9-15-14-22-17-11-6-5-10-16(15)17/h5-6,10-11,14,22H,3-4,7-9,12-13H2,1-2H3,(H2,19,20,21) |
| InChIKey | IRDFXRSCPKYGLF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|