C23H32IN5 — CID 110997034
1-[3-[4-(dimethylamino)phenyl]propyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 110997034) has the molecular formula C23H32IN5 and a molecular weight of 505.45 g/mol. Its IUPAC name is 1-[3-[4-(dimethylamino)phenyl]propyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[3-[4-(dimethylamino)phenyl]propyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110997034 |
| Molecular Formula | C23H32IN5 |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | 1-[3-[4-(dimethylamino)phenyl]propyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1ccc(N(C)C)cc1)NCCc1c[nH]c2ccccc12.I |
| InChI | InChI=1S/C23H31N5.HI/c1-24-23(25-15-6-7-18-10-12-20(13-11-18)28(2)3)26-16-14-19-17-27-22-9-5-4-8-21(19)22;/h4-5,8-13,17,27H,6-7,14-16H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | CKKWRBDFFCOEBC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|