C22H29FIN5 — CID 111968196
1-[2-[(4-fluorophenyl)methyl-methylamino]ethyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111968196) has the molecular formula C22H29FIN5 and a molecular weight of 509.41 g/mol. Its IUPAC name is 1-[2-[(4-fluorophenyl)methyl-methylamino]ethyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-[(4-fluorophenyl)methyl-methylamino]ethyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111968196 |
| Molecular Formula | C22H29FIN5 |
| Molecular Weight | 509.41 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | 1-[2-[(4-fluorophenyl)methyl-methylamino]ethyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2ccccc12)NCCN(C)Cc1ccc(F)cc1.I |
| InChI | InChI=1S/C22H28FN5.HI/c1-24-22(25-12-11-18-15-27-21-6-4-3-5-20(18)21)26-13-14-28(2)16-17-7-9-19(23)10-8-17;/h3-10,15,27H,11-14,16H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | XANWGHMFKSJDHM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|