C19H21F2IN4 — CID 111779722
1-[(2,5-difluorophenyl)methyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111779722) has the molecular formula C19H21F2IN4 and a molecular weight of 470.31 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111779722 |
| Molecular Formula | C19H21F2IN4 |
| Molecular Weight | 470.31 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2ccccc12)NCc1cc(F)ccc1F.I |
| InChI | InChI=1S/C19H20F2N4.HI/c1-22-19(25-12-14-10-15(20)6-7-17(14)21)23-9-8-13-11-24-18-5-3-2-4-16(13)18;/h2-7,10-11,24H,8-9,12H2,1H3,(H2,22,23,25);1H |
| InChIKey | WMQYTEIDXKQOHP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|