C20H24FIN4 — CID 111264534
1-[(2-fluorophenyl)methyl]-2-methyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111264534) has the molecular formula C20H24FIN4 and a molecular weight of 466.34 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-2-methyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(2-fluorophenyl)methyl]-2-methyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111264534 |
| Molecular Formula | C20H24FIN4 |
| Molecular Weight | 466.34 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-2-methyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2cc(C)ccc12)NCc1ccccc1F.I |
| InChI | InChI=1S/C20H23FN4.HI/c1-14-7-8-17-15(12-24-19(17)11-14)9-10-23-20(22-2)25-13-16-5-3-4-6-18(16)21;/h3-8,11-12,24H,9-10,13H2,1-2H3,(H2,22,23,25);1H |
| InChIKey | VDCHOKRNGIJHOQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|