C18H26F3N5 — CID 110996723
1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine (PubChem CID 110996723) has the molecular formula C18H26F3N5 and a molecular weight of 369.44 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine.
| Compound Name | 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine |
|---|---|
| PubChem CID | 110996723 |
| Molecular Formula | C18H26F3N5 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine |
| SMILES | C/N=C(\NCCCN(C)CC(F)(F)F)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H26F3N5/c1-22-17(23-9-5-11-26(2)13-18(19,20)21)24-10-8-14-12-25-16-7-4-3-6-15(14)16/h3-4,6-7,12,25H,5,8-11,13H2,1-2H3,(H2,22,23,24) |
| InChIKey | KIVIZUQGVBNXIR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|