C19H28F3N5 — CID 111973918
2-methyl-1-[2-(6-methyl-1H-indol-3-yl)ethyl]-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine (PubChem CID 111973918) has the molecular formula C19H28F3N5 and a molecular weight of 383.46 g/mol. Its IUPAC name is 2-methyl-1-[2-(6-methyl-1H-indol-3-yl)ethyl]-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine.
| Compound Name | 2-methyl-1-[2-(6-methyl-1H-indol-3-yl)ethyl]-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine |
|---|---|
| PubChem CID | 111973918 |
| Molecular Formula | C19H28F3N5 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | 2-methyl-1-[2-(6-methyl-1H-indol-3-yl)ethyl]-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine |
| SMILES | C/N=C(\NCCCN(C)CC(F)(F)F)NCCc1c[nH]c2cc(C)ccc12 |
| InChI | InChI=1S/C19H28F3N5/c1-14-5-6-16-15(12-26-17(16)11-14)7-9-25-18(23-2)24-8-4-10-27(3)13-19(20,21)22/h5-6,11-12,26H,4,7-10,13H2,1-3H3,(H2,23,24,25) |
| InChIKey | TYVPVGVNBZWMIT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|