C19H28F4IN5 — CID 111888806
1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide (PubChem CID 111888806) has the molecular formula C19H28F4IN5 and a molecular weight of 529.36 g/mol. Its IUPAC name is 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111888806 |
| Molecular Formula | C19H28F4IN5 |
| Molecular Weight | 529.36 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCN(C)CC(F)(F)F)NCCc1c[nH]c2cc(F)ccc12.I |
| InChI | InChI=1S/C19H27F4N5.HI/c1-3-24-18(25-8-4-10-28(2)13-19(21,22)23)26-9-7-14-12-27-17-11-15(20)5-6-16(14)17;/h5-6,11-12,27H,3-4,7-10,13H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | PTLLJABEQHKJJD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|