C21H34FIN6 — CID 111888842
1-ethyl-2-[2-(4-ethylpiperazin-1-yl)ethyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111888842) has the molecular formula C21H34FIN6 and a molecular weight of 516.45 g/mol. Its IUPAC name is 1-ethyl-2-[2-(4-ethylpiperazin-1-yl)ethyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(4-ethylpiperazin-1-yl)ethyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111888842 |
| Molecular Formula | C21H34FIN6 |
| Molecular Weight | 516.45 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | 1-ethyl-2-[2-(4-ethylpiperazin-1-yl)ethyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCN1CCN(CC)CC1)NCCc1c[nH]c2cc(F)ccc12.I |
| InChI | InChI=1S/C21H33FN6.HI/c1-3-23-21(25-9-10-28-13-11-27(4-2)12-14-28)24-8-7-17-16-26-20-15-18(22)5-6-19(17)20;/h5-6,15-16,26H,3-4,7-14H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | PUUONJBJWURKBH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|