C19H29FIN5O — CID 111888210
3-[[ethylamino-[2-(6-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]-N-propylpropanamide;hydroiodide (PubChem CID 111888210) has the molecular formula C19H29FIN5O and a molecular weight of 489.38 g/mol. Its IUPAC name is 3-[[ethylamino-[2-(6-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]-N-propylpropanamide;hydroiodide.
| Compound Name | 3-[[ethylamino-[2-(6-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]-N-propylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111888210 |
| Molecular Formula | C19H29FIN5O |
| Molecular Weight | 489.38 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 3-[[ethylamino-[2-(6-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]-N-propylpropanamide;hydroiodide |
| SMILES | CCCNC(=O)CC/N=C(\NCC)NCCc1c[nH]c2cc(F)ccc12.I |
| InChI | InChI=1S/C19H28FN5O.HI/c1-3-9-22-18(26)8-11-24-19(21-4-2)23-10-7-14-13-25-17-12-15(20)5-6-16(14)17;/h5-6,12-13,25H,3-4,7-11H2,1-2H3,(H,22,26)(H2,21,23,24);1H |
| InChIKey | ANYORQHAYNVXOM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|