C18H26N4O2 — CID 110996155
ethyl 4-[[N-[2-(1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]butanoate (PubChem CID 110996155) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is ethyl 4-[[N-[2-(1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]butanoate.
| Compound Name | ethyl 4-[[N-[2-(1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]butanoate |
|---|---|
| PubChem CID | 110996155 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | ethyl 4-[[N-[2-(1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]butanoate |
| SMILES | CCOC(=O)CCCN/C(=N\C)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H26N4O2/c1-3-24-17(23)9-6-11-20-18(19-2)21-12-10-14-13-22-16-8-5-4-7-15(14)16/h4-5,7-8,13,22H,3,6,9-12H2,1-2H3,(H2,19,20,21) |
| InChIKey | XEBKSTKJLLGAGM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|