C20H23N5O — CID 110996403
4-[[[N-[2-(1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide (PubChem CID 110996403) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is 4-[[[N-[2-(1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide.
| Compound Name | 4-[[[N-[2-(1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 110996403 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 4-[[[N-[2-(1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(/NCCc1c[nH]c2ccccc12)NCc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C20H23N5O/c1-22-20(25-12-14-6-8-15(9-7-14)19(21)26)23-11-10-16-13-24-18-5-3-2-4-17(16)18/h2-9,13,24H,10-12H2,1H3,(H2,21,26)(H2,22,23,25) |
| InChIKey | AVZLRMWEKSPFCA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 95.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|