C19H23N5O2S — CID 110996065
1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[(4-sulfamoylphenyl)methyl]guanidine (PubChem CID 110996065) has the molecular formula C19H23N5O2S and a molecular weight of 385.49 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[(4-sulfamoylphenyl)methyl]guanidine.
| Compound Name | 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[(4-sulfamoylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 110996065 |
| Molecular Formula | C19H23N5O2S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[(4-sulfamoylphenyl)methyl]guanidine |
| SMILES | C/N=C(/NCCc1c[nH]c2ccccc12)NCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C19H23N5O2S/c1-21-19(24-12-14-6-8-16(9-7-14)27(20,25)26)22-11-10-15-13-23-18-5-3-2-4-17(15)18/h2-9,13,23H,10-12H2,1H3,(H2,20,25,26)(H2,21,22,24) |
| InChIKey | HDYCBFWFFBSDNA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 112.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|