C21H27N5O2S — CID 110996215
1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[[3-(methylsulfamoylmethyl)phenyl]methyl]guanidine (PubChem CID 110996215) has the molecular formula C21H27N5O2S and a molecular weight of 413.55 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[[3-(methylsulfamoylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[[3-(methylsulfamoylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 110996215 |
| Molecular Formula | C21H27N5O2S |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[[3-(methylsulfamoylmethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCCc1c[nH]c2ccccc12)NCc1cccc(CS(=O)(=O)NC)c1 |
| InChI | InChI=1S/C21H27N5O2S/c1-22-21(24-11-10-18-14-25-20-9-4-3-8-19(18)20)26-13-16-6-5-7-17(12-16)15-29(27,28)23-2/h3-9,12,14,23,25H,10-11,13,15H2,1-2H3,(H2,22,24,26) |
| InChIKey | QNFNBYSOIQZRRS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|