C16H19ClN2S — CID 2996929
2-(1H-indol-3-yl)-N-[(5-methylthiophen-2-yl)methyl]ethanamine;hydrochloride (PubChem CID 2996929) has the molecular formula C16H19ClN2S and a molecular weight of 306.86 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N-[(5-methylthiophen-2-yl)methyl]ethanamine;hydrochloride.
| Compound Name | 2-(1H-indol-3-yl)-N-[(5-methylthiophen-2-yl)methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 2996929 |
| Molecular Formula | C16H19ClN2S |
| Molecular Weight | 306.86 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2-(1H-indol-3-yl)-N-[(5-methylthiophen-2-yl)methyl]ethanamine;hydrochloride |
| SMILES | Cc1ccc(CNCCc2c[nH]c3ccccc23)s1.Cl |
| InChI | InChI=1S/C16H18N2S.ClH/c1-12-6-7-14(19-12)11-17-9-8-13-10-18-16-5-3-2-4-15(13)16;/h2-7,10,17-18H,8-9,11H2,1H3;1H |
| InChIKey | RUPZDRRFSCTFEV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.86 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|